CAS 34284-75-8 is the registry number for 4-(2-Aminoethyl)benzene-1-sulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(2-aminoethyl)benzenesulfonyl fluoride (CAS 34284-75-8) is a chemical compound with the molecular formula C8H10FNO2S and a molecular weight of 203.24 g/mol. IUPAC name: 4-(2-aminoethyl)benzenesulfonyl fluoride. InChIKey: MGSKVZWGBWPBTF-UHFFFAOYSA-N.
| Molecular formula | C8H10FNO2S |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-(2-aminoethyl)benzenesulfonyl fluoride |
| InChIKey | MGSKVZWGBWPBTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)S(=O)(=O)F |
Computed by PubChem (NCBI)