Products 34284-75-8

CAS 34284-75-8 is the registry number for 4-(2-Aminoethyl)benzene-1-sulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(2-aminoethyl)benzenesulfonyl fluoride (CAS 34284-75-8) is a chemical compound with the molecular formula C8H10FNO2S and a molecular weight of 203.24 g/mol. IUPAC name: 4-(2-aminoethyl)benzenesulfonyl fluoride. InChIKey: MGSKVZWGBWPBTF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10FNO2S
Molecular weight203.24 g/mol
IUPAC name4-(2-aminoethyl)benzenesulfonyl fluoride
InChIKeyMGSKVZWGBWPBTF-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCN)S(=O)(=O)F

Computed by PubChem (NCBI)