cas: 366-79-0 — see every product listed under this CAS number, including other names
4-Fluorohippuric Acid, >98.0%(GC)(T) (CAS 366-79-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F1162-200MG |
| cas | 366-79-0 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 187.19 Pln | |
| TCI | 1g | 610.07 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-[(4-fluorobenzoyl)amino]acetic acid (CAS 366-79-0) is a chemical compound with the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. IUPAC name: 2-[(4-fluorobenzoyl)amino]acetic acid. InChIKey: NVWXSGQHHUSSOU-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO3 |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 2-[(4-fluorobenzoyl)amino]acetic acid |
| InChIKey | NVWXSGQHHUSSOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)F |
Computed by PubChem (NCBI)