CAS 49579-56-8 appears in our catalog under these names: 2-Acetamido-5-fluorobenzoic acid, 96%, 2-Acetamido-5-fluorobenzoic acid, 95+%, 2-Acetamido-5-fluorobenzoic acid, 2-Acetamido-5-fluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
2-acetamido-5-fluorobenzoic acid (CAS 49579-56-8) is a chemical compound with the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. IUPAC name: 2-acetamido-5-fluorobenzoic acid. InChIKey: QNHDURZULPJHIT-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO3 |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 2-acetamido-5-fluorobenzoic acid |
| InChIKey | QNHDURZULPJHIT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)