cas: 54049-92-2 — see every product listed under this CAS number, including other names
4-Formyl-N,N-dimethylbenzenesulfonamide, 98% (CAS 54049-92-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A189956-1g |
| cas | 54049-92-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 13949.32 Pln | |
| AmBeed | 5g | 41369.44 Pln | |
| AmBeed | 10g | 50040.76 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-formyl-N,N-dimethylbenzenesulfonamide (CAS 54049-92-2) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: 4-formyl-N,N-dimethylbenzenesulfonamide. InChIKey: OENABLBTFNNIDC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 4-formyl-N,N-dimethylbenzenesulfonamide |
| InChIKey | OENABLBTFNNIDC-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)