CAS 1394918-86-5 is the registry number for 4-(Azetidine-1-sulfonyl)phenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(azetidin-1-ylsulfonyl)phenol (CAS 1394918-86-5) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: 4-(azetidin-1-ylsulfonyl)phenol. InChIKey: YLPHXPWCJZZHNQ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 4-(azetidin-1-ylsulfonyl)phenol |
| InChIKey | YLPHXPWCJZZHNQ-UHFFFAOYSA-N |
| SMILES | C1CN(C1)S(=O)(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)