cas: 104949-82-8 — see every product listed under this CAS number, including other names
4-Hexyloxyphthalonitrile, >95.0%(GC) (CAS 104949-82-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0691-1G |
| cas | 104949-82-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 226.52 Pln | |
| TCI | 5g | 664.16 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
4-hexoxybenzene-1,2-dicarbonitrile (CAS 104949-82-8) is a chemical compound with the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. IUPAC name: 4-hexoxybenzene-1,2-dicarbonitrile. InChIKey: BMXSATBWGFIAPA-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 4-hexoxybenzene-1,2-dicarbonitrile |
| InChIKey | BMXSATBWGFIAPA-UHFFFAOYSA-N |
| SMILES | CCCCCCOC1=CC(=C(C=C1)C#N)C#N |
Computed by PubChem (NCBI)