CAS 890093-83-1 is the registry number for 1-(2-Aminoquinolin-3-yl)-2,2-dimethylpropan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2-aminoquinolin-3-yl)-2,2-dimethylpropan-1-one (CAS 890093-83-1) is a chemical compound with the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. IUPAC name: 1-(2-aminoquinolin-3-yl)-2,2-dimethylpropan-1-one. InChIKey: LXXKGZMUHZNSDB-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 1-(2-aminoquinolin-3-yl)-2,2-dimethylpropan-1-one |
| InChIKey | LXXKGZMUHZNSDB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC2=CC=CC=C2N=C1N |
Computed by PubChem (NCBI)