cas: 158227-26-0 — see every product listed under this CAS number, including other names
4-Hydroxy-2,2-dimethylchroman-5-carboxylic acid, 98%, 98% (CAS 158227-26-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYHI-100mg |
| cas | 158227-26-0 |
| size | 100mg |
| availability | 0.31g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 722.00 Pln | |
| Chemat | 250mg | 1053.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-hydroxy-2,2-dimethyl-3,4-dihydrochromene-5-carboxylic acid (CAS 158227-26-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 4-hydroxy-2,2-dimethyl-3,4-dihydrochromene-5-carboxylic acid. InChIKey: YEFMXAXWEWYHNI-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-hydroxy-2,2-dimethyl-3,4-dihydrochromene-5-carboxylic acid |
| InChIKey | YEFMXAXWEWYHNI-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C(C=CC=C2O1)C(=O)O)O)C |
Computed by PubChem (NCBI)