cas: 156839-10-0 — see every product listed under this CAS number, including other names
4-Hydroxy-2,3,5-trifluorobenzoic acid, 95%, 95% (CAS 156839-10-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYF5-100mg |
| cas | 156839-10-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,3,5-trifluoro-4-hydroxybenzoic acid (CAS 156839-10-0) is a chemical compound with the molecular formula C7H3F3O3 and a molecular weight of 192.09 g/mol. IUPAC name: 2,3,5-trifluoro-4-hydroxybenzoic acid. InChIKey: FKTSVSIMQRELDT-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O3 |
|---|---|
| Molecular weight | 192.09 g/mol |
| IUPAC name | 2,3,5-trifluoro-4-hydroxybenzoic acid |
| InChIKey | FKTSVSIMQRELDT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)O)F)F)C(=O)O |
Computed by PubChem (NCBI)