CAS 156839-10-0 appears in our catalog under these names: 4-Hydroxy-2,3,5-trifluorobenzoic acid, 98%, 4-Hydroxy-2,3,5-trifluorobenzoic acid, 4-Hydroxy-2,3,5-trifluorobenzoic acid, 95%, 95%, 2,3,5-trifluoro-4-hydroxybenzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg.
2,3,5-trifluoro-4-hydroxybenzoic acid (CAS 156839-10-0) is a chemical compound with the molecular formula C7H3F3O3 and a molecular weight of 192.09 g/mol. IUPAC name: 2,3,5-trifluoro-4-hydroxybenzoic acid. InChIKey: FKTSVSIMQRELDT-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O3 |
|---|---|
| Molecular weight | 192.09 g/mol |
| IUPAC name | 2,3,5-trifluoro-4-hydroxybenzoic acid |
| InChIKey | FKTSVSIMQRELDT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)O)F)F)C(=O)O |
Computed by PubChem (NCBI)