cas: 10537-86-7 — see every product listed under this CAS number, including other names
4-Hydroxy-3,5-bis(isopropyl)benzaldehyde, 97% (CAS 10537-86-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223249-250MG |
| cas | 10537-86-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1893.10 Pln | |
| Fluorochem | 10g | 3449.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-hydroxy-3,5-di(propan-2-yl)benzaldehyde (CAS 10537-86-7) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 4-hydroxy-3,5-di(propan-2-yl)benzaldehyde. InChIKey: WVGDLTQPAQUBMO-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 4-hydroxy-3,5-di(propan-2-yl)benzaldehyde |
| InChIKey | WVGDLTQPAQUBMO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)C=O |
Computed by PubChem (NCBI)