CAS 13423-73-9 appears in our catalog under these names: Propofol EP Impurity N, Propofol 4-Carboxylic Acid, >95% (HPLC), 4-Hydroxy-3,5-bis(1-methylethyl)benzoic Acid, 3,5-Diisopropyl-4-hydroxybenzoic acid, 4-Hydroxy-3,5-diisopropylbenzoic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Chemat. Available pack sizes: on request, 10g, 1g, 4x25mg, 25mg, 0,5g, 2g, 5g.
4-hydroxy-3,5-di(propan-2-yl)benzoic acid (CAS 13423-73-9) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 4-hydroxy-3,5-di(propan-2-yl)benzoic acid. InChIKey: WYAZPCLFZZTVSP-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 4-hydroxy-3,5-di(propan-2-yl)benzoic acid |
| InChIKey | WYAZPCLFZZTVSP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)C(=O)O |
Computed by PubChem (NCBI)