cas: 857651-06-0 — see every product listed under this CAS number, including other names
4-Hydroxy-4-[5-(pyrimidin-2-yl)pyridin-2-yl]cyclohexan-1-one, 98%, 98% (CAS 857651-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GABQ-100mg |
| cas | 857651-06-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 976.40 Pln | |
| Chemat | 1g | 2109.20 Pln | |
| Chemat | 5g | 6203.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-hydroxy-4-(5-pyrimidin-2-yl-2-pyridinyl)cyclohexan-1-one (CAS 857651-06-0) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: 4-hydroxy-4-(5-pyrimidin-2-yl-2-pyridinyl)cyclohexan-1-one. InChIKey: SCFKTBHPKNQOBT-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 4-hydroxy-4-(5-pyrimidin-2-yl-2-pyridinyl)cyclohexan-1-one |
| InChIKey | SCFKTBHPKNQOBT-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C2=NC=C(C=C2)C3=NC=CC=N3)O |
Computed by PubChem (NCBI)