CAS 924025-34-3 appears in our catalog under these names: 3-(2,4-Dimethylpyrimido[1,2-b]indazol-3-yl)propanoic acid, 95%, 3-{2,4-dimethylpyrimido(1,2-b)indazol-3-yl}propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanoic acid (CAS 924025-34-3) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: 3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanoic acid. InChIKey: MSBHZPKNCYTONU-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanoic acid |
| InChIKey | MSBHZPKNCYTONU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=C3C=CC=CC3=NN12)C)CCC(=O)O |
Computed by PubChem (NCBI)