cas: 1070879-87-6 — see every product listed under this CAS number, including other names
4-Hydroxy-8-methyl-2-propylquinoline, 98%, 98% (CAS 1070879-87-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118B74-250mg |
| cas | 1070879-87-6 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-methyl-2-propyl-1H-quinolin-4-one (CAS 1070879-87-6) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 8-methyl-2-propyl-1H-quinolin-4-one. InChIKey: LBIWAWKGQRGEIB-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 8-methyl-2-propyl-1H-quinolin-4-one |
| InChIKey | LBIWAWKGQRGEIB-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=O)C2=CC=CC(=C2N1)C |
Computed by PubChem (NCBI)