cas: 85858-94-2 — see every product listed under this CAS number, including other names
4-Hydroxybenzoyl-1-methylpiperazine (CAS 85858-94-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040682-250MG |
| cas | 85858-94-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 500mg | 346.77 Pln | |
| Fluorochem | 1g | 763.29 Pln |
| delivery time | 2-3 weeks |
|---|
(4-hydroxyphenyl)-(4-methylpiperazin-1-yl)methanone (CAS 85858-94-2) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: (4-hydroxyphenyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: NGNUDVSZXGEJKN-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | (4-hydroxyphenyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | NGNUDVSZXGEJKN-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)