cas: 122-37-2 — see every product listed under this CAS number, including other names
4-Hydroxydiphenylamine 98% (CAS 122-37-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213490-25g |
| cas | 122-37-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 748.62 Pln | |
| Ambeed | 500g | 2767.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A213490 |
4-Hydroxydiphenylamine is primary aromatic intermediate in the degradation of 6PPD.
Source: ChEBI
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-anilinophenol |
| InChIKey | JTTMYKSFKOOQLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)