cas: 774-94-7 — see every product listed under this CAS number, including other names
4-Hydroxyphenylsulfur pentafluoride, 95% (CAS 774-94-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MAY00197DA |
| cas | 774-94-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 436.79 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
4-(pentafluoro-lambda6-sulfanyl)phenol (CAS 774-94-7) is a chemical compound with the molecular formula C6H5F5OS and a molecular weight of 220.16 g/mol. IUPAC name: 4-(pentafluoro-lambda6-sulfanyl)phenol. InChIKey: XHJLGVIUMCBMHL-UHFFFAOYSA-N.
| Molecular formula | C6H5F5OS |
|---|---|
| Molecular weight | 220.16 g/mol |
| IUPAC name | 4-(pentafluoro-lambda6-sulfanyl)phenol |
| InChIKey | XHJLGVIUMCBMHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)