CAS 1126968-75-9 is the registry number for 2-Hydroxyphenylsulphur pentafluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(pentafluoro-lambda6-sulfanyl)phenol (CAS 1126968-75-9) is a chemical compound with the molecular formula C6H5F5OS and a molecular weight of 220.16 g/mol. IUPAC name: 2-(pentafluoro-lambda6-sulfanyl)phenol. InChIKey: FPVXSUWUMQLKCN-UHFFFAOYSA-N.
| Molecular formula | C6H5F5OS |
|---|---|
| Molecular weight | 220.16 g/mol |
| IUPAC name | 2-(pentafluoro-lambda6-sulfanyl)phenol |
| InChIKey | FPVXSUWUMQLKCN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)O)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)