cas: 99324-96-6 — see every product listed under this CAS number, including other names
4-Iodo-2-(trifluoromethyl)-1,1,1,2-tetrafluoro-butane (CAS 99324-96-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006675-1G |
| cas | 99324-96-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 25g | 1924.34 Pln |
| delivery time | 2-3 weeks |
|---|
1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane (CAS 99324-96-6) is a chemical compound with the molecular formula C5H4F7I and a molecular weight of 323.98 g/mol. IUPAC name: 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane. InChIKey: NRVDKMYDLZBFEH-UHFFFAOYSA-N.
| Molecular formula | C5H4F7I |
|---|---|
| Molecular weight | 323.98 g/mol |
| IUPAC name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane |
| InChIKey | NRVDKMYDLZBFEH-UHFFFAOYSA-N |
| SMILES | C(CI)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)