cas: 99324-96-6 — see every product listed under this CAS number, including other names
4-Iodo-2-trifluoromethyl-1,1,1,2-tetrafluorobutane, 98%+(GC),RG, 98%+(GC),RG (CAS 99324-96-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D65-250mg |
| cas | 99324-96-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 25g | 2090.00 Pln |
| purity | 98%+(GC),RG |
|---|---|
| delivery time | 3 weeks |
1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane (CAS 99324-96-6) is a chemical compound with the molecular formula C5H4F7I and a molecular weight of 323.98 g/mol. IUPAC name: 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane. InChIKey: NRVDKMYDLZBFEH-UHFFFAOYSA-N.
| Molecular formula | C5H4F7I |
|---|---|
| Molecular weight | 323.98 g/mol |
| IUPAC name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)butane |
| InChIKey | NRVDKMYDLZBFEH-UHFFFAOYSA-N |
| SMILES | C(CI)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)