cas: 38257-52-2 — see every product listed under this CAS number, including other names
4-Iodo-N,N-diphenylaniline 98% (CAS 38257-52-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A126928-100mg |
| cas | 38257-52-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 264.69 Pln | |
| Ambeed | 25g | 542.81 Pln | |
| Ambeed | 100g | 1816.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A126928 |
4-iodo-N,N-diphenylaniline (CAS 38257-52-2) is a chemical compound with the molecular formula C18H14IN and a molecular weight of 371.2 g/mol. IUPAC name: 4-iodo-N,N-diphenylaniline. InChIKey: OWWVTWHBNAWUJO-UHFFFAOYSA-N.
| Molecular formula | C18H14IN |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | 4-iodo-N,N-diphenylaniline |
| InChIKey | OWWVTWHBNAWUJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)I |
Computed by PubChem (NCBI)