CAS 38257-52-2 appears in our catalog under these names: 4-Iodotriphenylamine, >98.0%(GC), 4-Iodo-N,N-diphenylaniline 98%, 4-Iodo-N,N-Diphenylaniline, 98%, 98%, 4-Iodo-N,N-diphenylaniline, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g, 100g.
4-iodo-N,N-diphenylaniline (CAS 38257-52-2) is a chemical compound with the molecular formula C18H14IN and a molecular weight of 371.2 g/mol. IUPAC name: 4-iodo-N,N-diphenylaniline. InChIKey: OWWVTWHBNAWUJO-UHFFFAOYSA-N.
| Molecular formula | C18H14IN |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | 4-iodo-N,N-diphenylaniline |
| InChIKey | OWWVTWHBNAWUJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)I |
Computed by PubChem (NCBI)