CAS 887922-92-1 is the registry number for 4-Isocyanato-1-methyl-1H-indole, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
4-isocyanato-1-methylindole (CAS 887922-92-1) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 4-isocyanato-1-methylindole. InChIKey: TVGVHXVLMROUII-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 4-isocyanato-1-methylindole |
| InChIKey | TVGVHXVLMROUII-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C=CC=C21)N=C=O |
Computed by PubChem (NCBI)