cas: 77106-50-4 — see every product listed under this CAS number, including other names
4-Isopropoxy-1,2-dimethoxybenzene, 98% (CAS 77106-50-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1659472-25g |
| cas | 77106-50-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 13272.28 Pln | |
| AmBeed | 10g | 6755.77 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,2-dimethoxy-4-propan-2-yloxybenzene (CAS 77106-50-4) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 1,2-dimethoxy-4-propan-2-yloxybenzene. InChIKey: MWLNBEDFVCGBCX-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1,2-dimethoxy-4-propan-2-yloxybenzene |
| InChIKey | MWLNBEDFVCGBCX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)