Products 82428-30-6
CAS 82428-30-6 appears in our catalog under these names: 3,4-Epoxycyclohexylmethyl methacrylate, 95%, 3，4–Epoxycyclohexylmethyl methacrylate, 7-Oxabicyclo[4.1.0]heptan-3-ylmethyl methacrylate 95%, 3,4-Epoxycyclohexylmethyl methacrylate, 97%, 97%, 7-Oxabicyclo[4.1.0]heptan-3-ylmethyl methacrylate, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250g, 50g, 100g, 500g, 1000g.
[(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate (CAS 82428-30-6) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate. InChIKey: FYYIUODUDSPAJQ-XVBQNVSMSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | [(1S,6R)-7-oxabicyclo[4.1.0]heptan-3-yl]methyl 2-methylprop-2-enoate |
| InChIKey | FYYIUODUDSPAJQ-XVBQNVSMSA-N |
| SMILES | CC(=C)C(=O)OCC1CC[C@@H]2[C@H](C1)O2 |
Computed by PubChem (NCBI)