cas: 75081-21-9 — see every product listed under this CAS number, including other names
4-Isopropyl-9H-thioxanthen-9-one (CAS 75081-21-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602346-25G |
| cas | 75081-21-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 747.67 Pln | |
| Fluorochem | 100g | 2221.11 Pln |
| delivery time | 3-4 weeks |
|---|
1-propan-2-ylthioxanthen-9-one (CAS 75081-21-9) is a chemical compound with the molecular formula C16H14OS and a molecular weight of 254.3 g/mol. IUPAC name: 1-propan-2-ylthioxanthen-9-one. InChIKey: YIKSHDNOAYSSPX-UHFFFAOYSA-N.
| Molecular formula | C16H14OS |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 1-propan-2-ylthioxanthen-9-one |
| InChIKey | YIKSHDNOAYSSPX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=CC=C1)SC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)