cas: 928664-98-6 — see every product listed under this CAS number, including other names
4-Isoxazoleboronic acid pinacol ester, 98% (CAS 928664-98-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 250mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | PN-8875-25g |
| cas | 928664-98-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 10g | 534.20 Pln | |
| Fluorochem | 25g | 987.17 Pln | |
| Fluorochem | 100g | 2939.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (CAS 928664-98-6) is a chemical compound with the molecular formula C9H14BNO3 and a molecular weight of 195.03 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole. InChIKey: LXCICYRNWIGDQA-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO3 |
|---|---|
| Molecular weight | 195.03 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| InChIKey | LXCICYRNWIGDQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CON=C2 |
Computed by PubChem (NCBI)