CAS 1218790-95-4 appears in our catalog under these names: 2-Isobutoxypyridine-3-boronic acid, 96%, 2-Isobutoxypyridine-3-boronic acid, 98%, 98%, (2-Isobutoxypyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg.
[2-(2-methylpropoxy)-3-pyridinyl]boronic acid (CAS 1218790-95-4) is a chemical compound with the molecular formula C9H14BNO3 and a molecular weight of 195.03 g/mol. IUPAC name: [2-(2-methylpropoxy)-3-pyridinyl]boronic acid. InChIKey: VMPOWUYMVMJUSI-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO3 |
|---|---|
| Molecular weight | 195.03 g/mol |
| IUPAC name | [2-(2-methylpropoxy)-3-pyridinyl]boronic acid |
| InChIKey | VMPOWUYMVMJUSI-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)OCC(C)C)(O)O |
Computed by PubChem (NCBI)