cas: 39811-17-1 — see every product listed under this CAS number, including other names
4-Methoxy-[1,1'-biphenyl]-3-amine 98% (CAS 39811-17-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241771-1g |
| cas | 39811-17-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 748.62 Pln | |
| Ambeed | 10g | 1054.56 Pln | |
| Ambeed | 25g | 1877.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A241771 |
2-methoxy-5-phenylaniline (CAS 39811-17-1) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 2-methoxy-5-phenylaniline. InChIKey: DTYBRSLINXBXMP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-methoxy-5-phenylaniline |
| InChIKey | DTYBRSLINXBXMP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)