CAS 39811-17-1 appears in our catalog under these names: 5-Phenyl-o-anisidine, 98%, 3–Amino–4–methoxybiphenyl, 3-Amino-4-methoxybiphenyl, >98.0%(T), 5-PHENYL-O-ANISIDINE, 98+%, 4-Methoxy-[1,1'-biphenyl]-3-amine, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 100mg.
2-methoxy-5-phenylaniline (CAS 39811-17-1) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 2-methoxy-5-phenylaniline. InChIKey: DTYBRSLINXBXMP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-methoxy-5-phenylaniline |
| InChIKey | DTYBRSLINXBXMP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)