cas: 1305711-34-5 — see every product listed under this CAS number, including other names
4-Methoxy-1-methyl-1H-indazol-3-amine 97% (CAS 1305711-34-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A404934-100mg |
| cas | 1305711-34-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 865.44 Pln | |
| Ambeed | 5g | 2984.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A404934 |
4-methoxy-1-methylindazol-3-amine (CAS 1305711-34-5) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 4-methoxy-1-methylindazol-3-amine. InChIKey: NYVQTRCMCJMRST-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4-methoxy-1-methylindazol-3-amine |
| InChIKey | NYVQTRCMCJMRST-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC=C2)OC)C(=N1)N |
Computed by PubChem (NCBI)