CAS 328546-66-3 appears in our catalog under these names: 9-Amino-1,2,3,4-tetrahydro-5h-1,4-benzodiazepin-5-one, 95%, 9-amino-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-5-one, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 100mg, 500mg.
9-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 328546-66-3) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 9-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: XVHVPDMTBPMQAQ-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 9-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | XVHVPDMTBPMQAQ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)C(=CC=C2)N |
Computed by PubChem (NCBI)