cas: 937591-48-5 — see every product listed under this CAS number, including other names
4-Methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97%, 97% (CAS 937591-48-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHSC-100mg |
| cas | 937591-48-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 659.60 Pln | |
| Chemat | 1g | 1614.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 937591-48-5) is a chemical compound with the molecular formula C13H19BO4 and a molecular weight of 250.10 g/mol. IUPAC name: 4-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: URRPKAAGJYPAPH-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4 |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 4-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | URRPKAAGJYPAPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC)O |
Computed by PubChem (NCBI)