cas: 19013-30-0 — see every product listed under this CAS number, including other names
4-Methoxyphenyl methanesulfonate 98% (CAS 19013-30-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A883730-1g |
| cas | 19013-30-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 381.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A883730 |
(4-methoxyphenyl) methanesulfonate (CAS 19013-30-0) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: (4-methoxyphenyl) methanesulfonate. InChIKey: BZKNVCHUULQHAT-UHFFFAOYSA-N.
| Molecular formula | C8H10O4S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | (4-methoxyphenyl) methanesulfonate |
| InChIKey | BZKNVCHUULQHAT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OS(=O)(=O)C |
Computed by PubChem (NCBI)