Products 52200-03-0

CAS 52200-03-0 is the registry number for 3-Methoxyphenyl methanesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

(3-methoxyphenyl) methanesulfonate (CAS 52200-03-0) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: (3-methoxyphenyl) methanesulfonate. InChIKey: SMDKUUFVIRKUBB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O4S
Molecular weight202.23 g/mol
IUPAC name(3-methoxyphenyl) methanesulfonate
InChIKeySMDKUUFVIRKUBB-UHFFFAOYSA-N
SMILESCOC1=CC(=CC=C1)OS(=O)(=O)C

Computed by PubChem (NCBI)