CAS 52200-03-0 is the registry number for 3-Methoxyphenyl methanesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
(3-methoxyphenyl) methanesulfonate (CAS 52200-03-0) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: (3-methoxyphenyl) methanesulfonate. InChIKey: SMDKUUFVIRKUBB-UHFFFAOYSA-N.
| Molecular formula | C8H10O4S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | (3-methoxyphenyl) methanesulfonate |
| InChIKey | SMDKUUFVIRKUBB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)OS(=O)(=O)C |
Computed by PubChem (NCBI)