cas: 216955-61-2 — see every product listed under this CAS number, including other names
4-Methyl-2-[1-(tert-butoxycarbonyl)piperid-4-yl]1,3-thiazole-5-carboxylic acid, 95% (CAS 216955-61-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F518686-50MG |
| cas | 216955-61-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 378.01 Pln | |
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 500mg | 1013.20 Pln | |
| Fluorochem | 1g | 1283.94 Pln | |
| Fluorochem | 2.5g | 3121.84 Pln | |
| Fluorochem | 5g | 6188.46 Pln | |
| Fluorochem | 10g | 12321.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-5-carboxylic acid (CAS 216955-61-2) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-5-carboxylic acid. InChIKey: XDKKXEMKXSGKOR-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 4-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | XDKKXEMKXSGKOR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2CCN(CC2)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)