cas: 944401-55-2 — see every product listed under this CAS number, including other names
4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine, 97%, 97% (CAS 944401-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11II74-100mg |
| cas | 944401-55-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 4610.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 944401-55-2) is a chemical compound with the molecular formula C11H18BN3O2 and a molecular weight of 235.09 g/mol. IUPAC name: 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: SYJMHOBGFXCKRG-UHFFFAOYSA-N.
| Molecular formula | C11H18BN3O2 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | SYJMHOBGFXCKRG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2C)N |
Computed by PubChem (NCBI)