CAS 2813254-82-7 is the registry number for 1-Cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-triazole (CAS 2813254-82-7) is a chemical compound with the molecular formula C11H18BN3O2 and a molecular weight of 235.09 g/mol. IUPAC name: 1-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-triazole. InChIKey: OMLWHWBXTKHQRK-UHFFFAOYSA-N.
| Molecular formula | C11H18BN3O2 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 1-cyclopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-triazole |
| InChIKey | OMLWHWBXTKHQRK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=N2)C3CC3 |
Computed by PubChem (NCBI)