4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole 98%
cas: 1662682-33-8 — see every product listed under this CAS number, including other names
4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole 98% (CAS 1662682-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A692353-100mg |
| cas | 1662682-33-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 1822.19 Pln | |
| Ambeed | 10g | 3196.12 Pln | |
| Ambeed | 25g | 5910.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A692353 |
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1662682-33-8) is a chemical compound with the molecular formula C10H16BNO2S and a molecular weight of 225.12 g/mol. IUPAC name: 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: PKQNVRKSVXSVKS-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2S |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | PKQNVRKSVXSVKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CS2)C |
Computed by PubChem (NCBI)
Synonyms:
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, 4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 4-Methylthiazole-5-boronic acid pinacol ester, 4-Methyl-thiazole-5-boronic acid pinacol ester, 4-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, s12208, 4-Methyl-1,3-thiazole-5-boronic acid pinacol ester