4-Methylthiazole-5-boronic Acid Pinacol Ester, 97%, 97%
cas: 1662682-33-8 — see every product listed under this CAS number, including other names
4-Methylthiazole-5-boronic Acid Pinacol Ester, 97%, 97% (CAS 1662682-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZ6H-100mg |
| cas | 1662682-33-8 |
| size | 100mg |
| availability | 500g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 25g | 4197.20 Pln | |
| Chemat | 100g | 7437.20 Pln | |
| Chemat | 250g | 13346.00 Pln | |
| Chemat | 500g | 20059.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1662682-33-8) is a chemical compound with the molecular formula C10H16BNO2S and a molecular weight of 225.12 g/mol. IUPAC name: 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: PKQNVRKSVXSVKS-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2S |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | PKQNVRKSVXSVKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CS2)C |
Computed by PubChem (NCBI)
Synonyms:
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, 4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 4-Methylthiazole-5-boronic acid pinacol ester, 4-Methyl-thiazole-5-boronic acid pinacol ester, 4-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole, s12208, 4-Methyl-1,3-thiazole-5-boronic acid pinacol ester