Products 65958-37-4
CAS 65958-37-4 appears in our catalog under these names: 4-Methyl-5-nitrobenzene-1,2-diamine, 95%, 1,2-Benzenediamine, 4-methyl-5-nitro-, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-5-nitrobenzene-1,2-diamine (CAS 65958-37-4) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. IUPAC name: 4-methyl-5-nitrobenzene-1,2-diamine. InChIKey: VBZQQOZFOSOFLO-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 4-methyl-5-nitrobenzene-1,2-diamine |
| InChIKey | VBZQQOZFOSOFLO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])N)N |
Computed by PubChem (NCBI)