CAS 106690-38-4 is the registry number for 2-Methylamino-5-methyl-3-nitropyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 250mg.
N,5-dimethyl-3-nitropyridin-2-amine (CAS 106690-38-4) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. IUPAC name: N,5-dimethyl-3-nitropyridin-2-amine. InChIKey: CDLFFKOFUWNPCC-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | N,5-dimethyl-3-nitropyridin-2-amine |
| InChIKey | CDLFFKOFUWNPCC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)NC)[N+](=O)[O-] |
Computed by PubChem (NCBI)