cas: 3695-00-9 — see every product listed under this CAS number, including other names
4-Methyl-N-tosylbenzenesulfonamide (CAS 3695-00-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 15g, 50g, 75g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMIR-1g |
| cas | 3695-00-9 |
| size | 1g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 25g | 520.40 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 15g | 371.60 Pln | |
| Chemat | 50g | 938.00 Pln | |
| Chemat | 75g | 1360.40 Pln | |
| Chemat | 100g | 1720.40 Pln |
| delivery time | 3 weeks |
|---|
4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide (CAS 3695-00-9) is a chemical compound with the molecular formula C14H15NO4S2 and a molecular weight of 325.4 g/mol. IUPAC name: 4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide. InChIKey: LHWZLUXODWUHLZ-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4S2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
| InChIKey | LHWZLUXODWUHLZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)