CAS 3695-00-9 appears in our catalog under these names: Di-p-toluenesulfonamide, 98%, 4–Methyl–N–tosylbenzenesulfonamide, 4-Methyl-N-tosylbenzenesulfonamide, >98.0%(HPLC), 4-Methyl-N-tosylbenzenesulfonamide 98%, 4-Methyl-N-tosylbenzenesulfonamide. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 250mg, 10g, 15g, 50g, 75g.
4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide (CAS 3695-00-9) is a chemical compound with the molecular formula C14H15NO4S2 and a molecular weight of 325.4 g/mol. IUPAC name: 4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide. InChIKey: LHWZLUXODWUHLZ-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4S2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
| InChIKey | LHWZLUXODWUHLZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)