cas: 2423-73-6 — see every product listed under this CAS number, including other names
4-Nitro-2,6-diphenylphenol, 98.0%, 98.0% (CAS 2423-73-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LUN-1g |
| cas | 2423-73-6 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 448.40 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
4-nitro-2,6-diphenylphenol (CAS 2423-73-6) is a chemical compound with the molecular formula C18H13NO3 and a molecular weight of 291.3 g/mol. IUPAC name: 4-nitro-2,6-diphenylphenol. InChIKey: YCXQKJXTGDYKIO-UHFFFAOYSA-N.
| Molecular formula | C18H13NO3 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 4-nitro-2,6-diphenylphenol |
| InChIKey | YCXQKJXTGDYKIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2O)C3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)