CAS 2423-73-6 appears in our catalog under these names: 4-Nitro-2,6-diphenylphenol, 95%, 4–Nitro–2，6–diphenylphenol, 4-Nitro-2,6-diphenylphenol, >98.0%(T), 5'-Nitro-[1,1':3',1''-terphenyl]-2'-ol, 95+%, 4-Nitro-2,6-Diphenylphenol, ≥98%(T). Offered by: Combi-blocks, GLPBio, TCI, Fluorochem, Chemat. Available pack sizes: 1g, 250mg.
4-nitro-2,6-diphenylphenol (CAS 2423-73-6) is a chemical compound with the molecular formula C18H13NO3 and a molecular weight of 291.3 g/mol. IUPAC name: 4-nitro-2,6-diphenylphenol. InChIKey: YCXQKJXTGDYKIO-UHFFFAOYSA-N.
| Molecular formula | C18H13NO3 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 4-nitro-2,6-diphenylphenol |
| InChIKey | YCXQKJXTGDYKIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2O)C3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)