CAS 1074-98-2 appears in our catalog under these names: 3-Methyl-4-nitropyridine 1-oxide, 98%, 98%, 4-Nitro-3-picoline-N-oxide/ 98%, 4-Nitro-3-picoline-n-oxide, 98%, 3-Methyl-4-nitropyridine 1-oxide, 98%, 3–Methyl–4–nitropyridine N–oxide. Offered by: Chemat, Fluorochem, Ambeed, GLPBio, TCI. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 50g, 500g.
3-methyl-4-nitro-1-oxidopyridin-1-ium (CAS 1074-98-2) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 3-methyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: SSOURMYKACOBIV-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 3-methyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | SSOURMYKACOBIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)