4-Nitrophenyl 4-(pyridin-2-yldisulfanyl)benzyl carbonate, 97%
cas: 1151989-04-6 — see every product listed under this CAS number, including other names
4-Nitrophenyl 4-(pyridin-2-yldisulfanyl)benzyl carbonate, 97% (CAS 1151989-04-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 5g, 50mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F545039-100MG |
| cas | 1151989-04-6 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1169.40 Pln | |
| Fluorochem | 250mg | 1726.49 Pln | |
| Fluorochem | 1g | 4173.55 Pln | |
| Ambeed | 25mg | 592.88 Pln | |
| Ambeed | 250mg | 1677.56 Pln | |
| Ambeed | 1g | 4086.12 Pln | |
| Ambeed | 5g | 12185.12 Pln | |
| Chemat | 25mg | 539.60 Pln | |
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1192.40 Pln | |
| Chemat | 1g | 3179.60 Pln | |
| BLDpharm | 25mg | 580.93 Pln | |
| BLDpharm | 50mg | 936.36 Pln | |
| BLDpharm | 100mg | 1219.60 Pln | |
| BLDpharm | 250mg | 1802.72 Pln | |
| BLDpharm | 1g | 4401.81 Pln | |
| BLDpharm | 5g | 13132.07 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(4-nitrophenyl) [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate (CAS 1151989-04-6) is a chemical compound with the molecular formula C19H14N2O5S2 and a molecular weight of 414.5 g/mol. IUPAC name: (4-nitrophenyl) [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate. InChIKey: VRPDVXLDCQQMEG-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O5S2 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | (4-nitrophenyl) [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate |
| InChIKey | VRPDVXLDCQQMEG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SSC2=CC=C(C=C2)COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-Nitrophenyl 4-(pyridin-2-yldisulfanyl)benzyl carbonate, 4-Nitrophenyl 4-(2-Pyridyldisulfanyl)benzyl Carbonate, (4-nitrophenyl) [4-(pyridin-2-yldisulfanyl)phenyl]methyl carbonate, 4-Nitrophenyl4-(pyridin-2-yldisulfanyl)benzylcarbonate, 4-nitrophenyl (4-(pyridin-2-yldisulfaneyl)benzyl) carbonate, (4-nitrophenyl) [4-(2-pyridyldisulfanyl)phenyl]methyl carbonate, Carbonic acid, 4-nitrophenyl [4-(2-pyridinyldithio)phenyl]methyl ester