cas: 610-27-5 — see every product listed under this CAS number, including other names
4-Nitrophthalic acid 98% (CAS 610-27-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175525-5g |
| cas | 610-27-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 131.19 Pln | |
| Ambeed | 100g | 192.38 Pln | |
| Ambeed | 500g | 414.88 Pln | |
| Ambeed | 1000g | 648.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175525 |
4-nitrophthalic acid (CAS 610-27-5) is a chemical compound with the molecular formula C8H5NO6 and a molecular weight of 211.13 g/mol. IUPAC name: 4-nitrophthalic acid. InChIKey: SLBQXWXKPNIVSQ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO6 |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | 4-nitrophthalic acid |
| InChIKey | SLBQXWXKPNIVSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)