Products 349586-66-9

CAS 349586-66-9 is the registry number for 5-Formyl-2-hydroxy-3-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-formyl-2-hydroxy-3-nitrobenzoic acid (CAS 349586-66-9) is a chemical compound with the molecular formula C8H5NO6 and a molecular weight of 211.13 g/mol. IUPAC name: 5-formyl-2-hydroxy-3-nitrobenzoic acid. InChIKey: MLFGDFDWWDRFFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO6
Molecular weight211.13 g/mol
IUPAC name5-formyl-2-hydroxy-3-nitrobenzoic acid
InChIKeyMLFGDFDWWDRFFJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)O)[N+](=O)[O-])C=O

Computed by PubChem (NCBI)